dipropyl d-tartrate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

dipropyl δ-tartarate; dipropyl δ-tartrate; n-propyl δ-tartarate; propyl δ-tartarate
Formula:C10H18O6; 234.25 g/mol
InChiKey:WCHBXSPACACNBJ-YUMQZZPRSA-N
SMILES:CCCOC(=O)[C@@H](O)[C@H](O)C(=O)OCCC
Molecular structure of dipropyl d-tartrate
Density:1.139 g/mL
Molar volume:205.7 mL/mol
Boiling point:297 °C
Antoine equation
P(Torr) vs T(°C)		Vapour pressure vs temperature

Isomers

diethyl (R*,R*)-2,3-dimethoxysuccinate
Molecular structure of diethyl (R*,R*)-2,3-dimethoxysuccinate
diethyl (R,S)-2,3-dimethoxysuccinate
Molecular structure of diethyl (R,S)-2,3-dimethoxysuccinate
diisopropyl δ-tartrate
Molecular structure of diisopropyl d-tartrate
dipropan-2-yl (2R,3R)-2,3-dihydroxybutanedioate
Molecular structure of dipropan-2-yl (2R,3R)-2,3-dihydroxybutanedioate
dipropyl δ-tartrate
Molecular structure of dipropyl d-tartrate
ethylenebis(oxyethylene) diacetate
Molecular structure of ethylenebis(oxyethylene) diacetate
  ::